Products 1114809-24-3

CAS 1114809-24-3 appears in our catalog under these names: 5-Bromo-3-methylpicolinoyl chloride, 97%, 5-Bromo-3-methylpyridine-2-carbonyl chloride, 95%, 5-Bromo-3-methylpyridine-2-carbonyl chloride, ≥97.8%, ≥97.8%. Offered by: AmBeed, Combi-blocks, Chemat. Available pack sizes: 25g, 10g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-bromo-3-methylpyridine-2-carbonyl chloride (CAS 1114809-24-3) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: 5-bromo-3-methylpyridine-2-carbonyl chloride. InChIKey: GYRYAHIYDINTAL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrClNO
Molecular weight234.48 g/mol
IUPAC name5-bromo-3-methylpyridine-2-carbonyl chloride
InChIKeyGYRYAHIYDINTAL-UHFFFAOYSA-N
SMILESCC1=CC(=CN=C1C(=O)Cl)Br

Computed by PubChem (NCBI)