cas: 412347-39-8 — see every product listed under this CAS number, including other names
1-(6-Bromopyridin-3-yl)piperazine, 96%, 96% (CAS 412347-39-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1183TY-100mg |
| cas | 412347-39-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 789.20 Pln | |
| Chemat | 500mg | 1230.80 Pln | |
| Chemat | 1g | 1811.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-(6-bromo-3-pyridinyl)piperazine (CAS 412347-39-8) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 1-(6-bromo-3-pyridinyl)piperazine. InChIKey: OVRZSDRDBJDKBF-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 1-(6-bromo-3-pyridinyl)piperazine |
| InChIKey | OVRZSDRDBJDKBF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CN=C(C=C2)Br |
Computed by PubChem (NCBI)