cas: 412347-39-8 — see every product listed under this CAS number, including other names
Piperazine, 1-(6-bromo-3-pyridinyl)-, 96% (CAS 412347-39-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517280-100MG |
| cas | 412347-39-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 497.76 Pln | |
| Fluorochem | 250mg | 518.59 Pln | |
| Fluorochem | 500mg | 549.82 Pln | |
| Fluorochem | 1g | 607.10 Pln | |
| Fluorochem | 5g | 1138.16 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-(6-bromo-3-pyridinyl)piperazine (CAS 412347-39-8) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 1-(6-bromo-3-pyridinyl)piperazine. InChIKey: OVRZSDRDBJDKBF-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 1-(6-bromo-3-pyridinyl)piperazine |
| InChIKey | OVRZSDRDBJDKBF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CN=C(C=C2)Br |
Computed by PubChem (NCBI)