cas: 89937-26-8 — see every product listed under this CAS number, including other names
1-(6-Chloropyridazin-3-yl)piperidin-4-ol, >97%, >97% (CAS 89937-26-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D2S-100mg |
| cas | 89937-26-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 582.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
1-(6-chloropyridazin-3-yl)piperidin-4-ol (CAS 89937-26-8) is a chemical compound with the molecular formula C9H12ClN3O and a molecular weight of 213.66 g/mol. IUPAC name: 1-(6-chloropyridazin-3-yl)piperidin-4-ol. InChIKey: GYVIZUPSUNWREG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1-(6-chloropyridazin-3-yl)piperidin-4-ol |
| InChIKey | GYVIZUPSUNWREG-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)