CAS 1701532-35-5 is the registry number for 5-Chloro-pyrazine-2-carboxylic acid diethylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-chloro-N,N-diethylpyrazine-2-carboxamide (CAS 1701532-35-5) is a chemical compound with the molecular formula C9H12ClN3O and a molecular weight of 213.66 g/mol. IUPAC name: 5-chloro-N,N-diethylpyrazine-2-carboxamide. InChIKey: YNQJKTGNOYQFBF-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 5-chloro-N,N-diethylpyrazine-2-carboxamide |
| InChIKey | YNQJKTGNOYQFBF-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CN=C(C=N1)Cl |
Computed by PubChem (NCBI)