CAS 1638603-70-9 is the registry number for (S)-2-(6-Chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl)ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[(3S)-6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]ethanol (CAS 1638603-70-9) is a chemical compound with the molecular formula C9H12ClN3O and a molecular weight of 213.66 g/mol. IUPAC name: 2-[(3S)-6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]ethanol. InChIKey: MCKBYIZPGFJNFU-LURJTMIESA-N.
| Molecular formula | C9H12ClN3O |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-[(3S)-6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]ethanol |
| InChIKey | MCKBYIZPGFJNFU-LURJTMIESA-N |
| SMILES | C1[C@@H](NC2=C(N1)C=CC(=N2)Cl)CCO |
Computed by PubChem (NCBI)