Products 945895-48-7
CAS 945895-48-7 is the registry number for 1-(2-Chloropyrimidin-4-yl)piperidin-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
1-(2-chloropyrimidin-4-yl)piperidin-3-ol (CAS 945895-48-7) is a chemical compound with the molecular formula C9H12ClN3O and a molecular weight of 213.66 g/mol. IUPAC name: 1-(2-chloropyrimidin-4-yl)piperidin-3-ol. InChIKey: OZTKPDVMLVHPOB-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1-(2-chloropyrimidin-4-yl)piperidin-3-ol |
| InChIKey | OZTKPDVMLVHPOB-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=NC(=NC=C2)Cl)O |
Computed by PubChem (NCBI)