CAS 392309-26-1 appears in our catalog under these names: 1-(Benzyloxy)-2,3,4-trifluorobenzene, 95%, 1-(Benzyloxy)-2,3,4-trifluorobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 10g, 5g, 1g.
1,2,3-trifluoro-4-phenylmethoxybenzene (CAS 392309-26-1) is a chemical compound with the molecular formula C13H9F3O and a molecular weight of 238.20 g/mol. IUPAC name: 1,2,3-trifluoro-4-phenylmethoxybenzene. InChIKey: PCEWMCPZCWGCIT-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 1,2,3-trifluoro-4-phenylmethoxybenzene |
| InChIKey | PCEWMCPZCWGCIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)F)F |
Computed by PubChem (NCBI)