CAS 365426-92-2 appears in our catalog under these names: 3-(3-Trifluoromethylphenyl)phenol, 96%, 3'-(Trifluoromethyl)-(1,1'-biphenyl)-3-ol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-[3-(trifluoromethyl)phenyl]phenol (CAS 365426-92-2) is a chemical compound with the molecular formula C13H9F3O and a molecular weight of 238.20 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]phenol. InChIKey: YLPOORUJYGDZAC-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]phenol |
| InChIKey | YLPOORUJYGDZAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)