CAS 2367-02-4 appears in our catalog under these names: 1–Phenoxy–4–(trifluoromethyl)benzene, 1-Phenoxy-4-(trifluoromethyl)benzene 97%, 4-(Trifluoromethyl)diphenyl ether, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
1-phenoxy-4-(trifluoromethyl)benzene (CAS 2367-02-4) is a chemical compound with the molecular formula C13H9F3O and a molecular weight of 238.20 g/mol. IUPAC name: 1-phenoxy-4-(trifluoromethyl)benzene. InChIKey: UZJUDUZMPNCXPF-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 1-phenoxy-4-(trifluoromethyl)benzene |
| InChIKey | UZJUDUZMPNCXPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)