CAS 330-58-5 is the registry number for 1-Phenoxy-3-(trifluoromethyl)benzene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-phenoxy-3-(trifluoromethyl)benzene (CAS 330-58-5) is a chemical compound with the molecular formula C13H9F3O and a molecular weight of 238.20 g/mol. IUPAC name: 1-phenoxy-3-(trifluoromethyl)benzene. InChIKey: NCKLXFNNEBEKEA-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 1-phenoxy-3-(trifluoromethyl)benzene |
| InChIKey | NCKLXFNNEBEKEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)