cas: 200956-32-7 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-2-bromo-4-(trifluoromethyl)benzene, 95%, 95% (CAS 200956-32-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113D4D-100mg |
| cas | 200956-32-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-phenylmethoxy-4-(trifluoromethyl)benzene (CAS 200956-32-7) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 2-bromo-1-phenylmethoxy-4-(trifluoromethyl)benzene. InChIKey: VIGCXRMJHAZXGW-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 2-bromo-1-phenylmethoxy-4-(trifluoromethyl)benzene |
| InChIKey | VIGCXRMJHAZXGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)