CAS 678164-30-2 is the registry number for 5-(Benzyloxy)-2-bromobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
1-bromo-4-phenylmethoxy-2-(trifluoromethyl)benzene (CAS 678164-30-2) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 1-bromo-4-phenylmethoxy-2-(trifluoromethyl)benzene. InChIKey: OIXYWYPMKGUGIM-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 1-bromo-4-phenylmethoxy-2-(trifluoromethyl)benzene |
| InChIKey | OIXYWYPMKGUGIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)