CAS 1044061-95-1 appears in our catalog under these names: 4-(Benzyloxy)-2-bromo-1-(trifluoromethyl)benzene, 95%, 95%, 4-Benzyloxy-2-bromo-1-trifluoromethylbenzene, 95%. Offered by: Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-4-phenylmethoxy-1-(trifluoromethyl)benzene (CAS 1044061-95-1) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 2-bromo-4-phenylmethoxy-1-(trifluoromethyl)benzene. InChIKey: DCNCLHCFZSJTEU-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 2-bromo-4-phenylmethoxy-1-(trifluoromethyl)benzene |
| InChIKey | DCNCLHCFZSJTEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)