Products 2179038-48-1
CAS 2179038-48-1 appears in our catalog under these names: 2'-Bromo-4-methyl-4'-(trifluoromethoxy)-1,1'-biphenyl, 95%, 2'-Bromo-4-methyl-4'-(trifluoromethoxy)-1,1'-biphenyl. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-bromo-1-(4-methylphenyl)-4-(trifluoromethoxy)benzene (CAS 2179038-48-1) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 2-bromo-1-(4-methylphenyl)-4-(trifluoromethoxy)benzene. InChIKey: XTLMSVFLAOONLM-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 2-bromo-1-(4-methylphenyl)-4-(trifluoromethoxy)benzene |
| InChIKey | XTLMSVFLAOONLM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=C(C=C2)OC(F)(F)F)Br |
Computed by PubChem (NCBI)