cas: 120-11-6 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-2-methoxy-4-(prop-1-en-1-yl)benzene 98% (CAS 120-11-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A226636-5g |
| cas | 120-11-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 303.62 Pln | |
| Ambeed | 500g | 921.06 Pln | |
| Ambeed | 1000g | 1694.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A226636 |
2-methoxy-1-phenylmethoxy-4-prop-1-enylbenzene (CAS 120-11-6) is a chemical compound with the molecular formula C17H18O2 and a molecular weight of 254.32 g/mol. IUPAC name: 2-methoxy-1-phenylmethoxy-4-prop-1-enylbenzene. InChIKey: YKSSSKBJDZDZTD-UHFFFAOYSA-N.
| Molecular formula | C17H18O2 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | 2-methoxy-1-phenylmethoxy-4-prop-1-enylbenzene |
| InChIKey | YKSSSKBJDZDZTD-UHFFFAOYSA-N |
| SMILES | CC=CC1=CC(=C(C=C1)OCC2=CC=CC=C2)OC |
Computed by PubChem (NCBI)