CAS 1215206-04-4 appears in our catalog under these names: 3'-tert-Butylbiphenyl-3-carboxylic acid, 98%, 3'-(tert-Butyl)-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(3-tert-butylphenyl)benzoic acid (CAS 1215206-04-4) is a chemical compound with the molecular formula C17H18O2 and a molecular weight of 254.32 g/mol. IUPAC name: 3-(3-tert-butylphenyl)benzoic acid. InChIKey: CIFFSZLDSORYNG-UHFFFAOYSA-N.
| Molecular formula | C17H18O2 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | 3-(3-tert-butylphenyl)benzoic acid |
| InChIKey | CIFFSZLDSORYNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)