CAS 14041-81-7 is the registry number for (4-tert-Butylphenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
(4-tert-butylphenyl) benzoate (CAS 14041-81-7) is a chemical compound with the molecular formula C17H18O2 and a molecular weight of 254.32 g/mol. IUPAC name: (4-tert-butylphenyl) benzoate. InChIKey: OWZCLYMEMJOKAC-UHFFFAOYSA-N.
| Molecular formula | C17H18O2 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | (4-tert-butylphenyl) benzoate |
| InChIKey | OWZCLYMEMJOKAC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)