Products 84392-26-7
CAS 84392-26-7 is the registry number for 2-(4-t-Butylphenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(4-tert-butylphenyl)benzoic acid (CAS 84392-26-7) is a chemical compound with the molecular formula C17H18O2 and a molecular weight of 254.32 g/mol. IUPAC name: 2-(4-tert-butylphenyl)benzoic acid. InChIKey: WYIJUURMGVBXEM-UHFFFAOYSA-N.
| Molecular formula | C17H18O2 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)benzoic acid |
| InChIKey | WYIJUURMGVBXEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-t-Butylphenyl)benzoic acid, 4'-(tert-Butyl)-[1,1'-biphenyl]-2-carboxylic acid, 2-(4-tert-butylphenyl)benzoic acid, 4'-Tert-butyl[1,1'-biphenyl]-2-carboxylic acid, 4'-(1,1-Dimethylethyl)[1,1'-biphenyl]-2-carboxylic acid, 4'-(tert-Butyl)-[1,1'-biphenyl]-2-carboxylicacid, WYIJUURMGVBXEM-UHFFFAOYSA-N, 4'-tert-Butylbiphenyl-2-carboxylic acid, 4'-(1,1-dimethylethyl)-[1,1'-Biphenyl]-2-carboxylic acid