cas: 72216-35-4 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-3-fluorobenzene (CAS 72216-35-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329825-5G |
| cas | 72216-35-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1237.08 Pln | |
| Fluorochem | 10g | 2059.71 Pln |
| delivery time | 3-4 weeks |
|---|
1-fluoro-3-phenylmethoxybenzene (CAS 72216-35-4) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: 1-fluoro-3-phenylmethoxybenzene. InChIKey: DIQOSFBOCFVINE-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-fluoro-3-phenylmethoxybenzene |
| InChIKey | DIQOSFBOCFVINE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)