cas: 7700-27-8 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-4-chlorobenzene 98% (CAS 7700-27-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A905904-5g |
| cas | 7700-27-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 882.12 Pln | |
| Ambeed | 500g | 3841.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A905904 |
1-chloro-4-phenylmethoxybenzene (CAS 7700-27-8) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: 1-chloro-4-phenylmethoxybenzene. InChIKey: OBCBJNFGAMHBTC-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 1-chloro-4-phenylmethoxybenzene |
| InChIKey | OBCBJNFGAMHBTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)