cas: 370-78-5 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-4-fluorobenzene, 98%, 98% (CAS 370-78-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D36-5g |
| cas | 370-78-5 |
| size | 5g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 203.60 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 1g | 83.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-fluoro-4-phenylmethoxybenzene (CAS 370-78-5) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: 1-fluoro-4-phenylmethoxybenzene. InChIKey: GOJNJAKUQZLPPP-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-fluoro-4-phenylmethoxybenzene |
| InChIKey | GOJNJAKUQZLPPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)