1-(Benzyloxy)-4-iodo-1H-pyrazole, 95%
cas: 229171-07-7 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-4-iodo-1H-pyrazole, 95% (CAS 229171-07-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A190697-250mg |
| cas | 229171-07-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 787.56 Pln | |
| Ambeed | 1g | 1855.56 Pln | |
| Ambeed | 5g | 6316.69 Pln | |
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 909.20 Pln | |
| Chemat | 1g | 2195.60 Pln | |
| Chemat | 5g | 7528.40 Pln | |
| BLDpharm | 100mg | 469.86 Pln | |
| BLDpharm | 250mg | 847.50 Pln | |
| BLDpharm | 1g | 1991.55 Pln | |
| BLDpharm | 5g | 6800.96 Pln | |
| Fluorochem | 100mg | 898.66 Pln | |
| Fluorochem | 250mg | 1674.43 Pln | |
| Fluorochem | 1g | 4059.01 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-iodo-1-phenylmethoxypyrazole (CAS 229171-07-7) is a chemical compound with the molecular formula C10H9IN2O and a molecular weight of 300.10 g/mol. IUPAC name: 4-iodo-1-phenylmethoxypyrazole. InChIKey: VLRXSAMTKJXSPK-UHFFFAOYSA-N.
| Molecular formula | C10H9IN2O |
|---|---|
| Molecular weight | 300.10 g/mol |
| IUPAC name | 4-iodo-1-phenylmethoxypyrazole |
| InChIKey | VLRXSAMTKJXSPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CON2C=C(C=N2)I |
Computed by PubChem (NCBI)