CAS 1314002-59-9 is the registry number for 5-Iodo-1-(3-methoxyphenyl)-1H-pyrazole, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
5-iodo-1-(3-methoxyphenyl)pyrazole (CAS 1314002-59-9) is a chemical compound with the molecular formula C10H9IN2O and a molecular weight of 300.10 g/mol. IUPAC name: 5-iodo-1-(3-methoxyphenyl)pyrazole. InChIKey: LSUOKEVOEARCMR-UHFFFAOYSA-N.
| Molecular formula | C10H9IN2O |
|---|---|
| Molecular weight | 300.10 g/mol |
| IUPAC name | 5-iodo-1-(3-methoxyphenyl)pyrazole |
| InChIKey | LSUOKEVOEARCMR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2C(=CC=N2)I |
Computed by PubChem (NCBI)