CAS 2854319-58-5 is the registry number for 7'-Iodo-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-[2,6]naphthyridin]-1'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-iodospiro[2,3-dihydro-2,6-naphthyridine-4,1'-cyclopropane]-1-one (CAS 2854319-58-5) is a chemical compound with the molecular formula C10H9IN2O and a molecular weight of 300.10 g/mol. IUPAC name: 7-iodospiro[2,3-dihydro-2,6-naphthyridine-4,1'-cyclopropane]-1-one. InChIKey: ZZSMLYHFFRMPTI-UHFFFAOYSA-N.
| Molecular formula | C10H9IN2O |
|---|---|
| Molecular weight | 300.10 g/mol |
| IUPAC name | 7-iodospiro[2,3-dihydro-2,6-naphthyridine-4,1'-cyclopropane]-1-one |
| InChIKey | ZZSMLYHFFRMPTI-UHFFFAOYSA-N |
| SMILES | C1CC12CNC(=O)C3=CC(=NC=C23)I |
Computed by PubChem (NCBI)