Products 2925423-69-2
CAS 2925423-69-2 is the registry number for 5-Iodo-2,3-dimethyl-1,7-naphthyridin-8(7H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-iodo-2,3-dimethyl-7H-1,7-naphthyridin-8-one (CAS 2925423-69-2) is a chemical compound with the molecular formula C10H9IN2O and a molecular weight of 300.10 g/mol. IUPAC name: 5-iodo-2,3-dimethyl-7H-1,7-naphthyridin-8-one. InChIKey: ZWURMUXLLKGUQH-UHFFFAOYSA-N.
| Molecular formula | C10H9IN2O |
|---|---|
| Molecular weight | 300.10 g/mol |
| IUPAC name | 5-iodo-2,3-dimethyl-7H-1,7-naphthyridin-8-one |
| InChIKey | ZWURMUXLLKGUQH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=O)NC=C2I)N=C1C |
Computed by PubChem (NCBI)