cas: 140690-56-8 — see every product listed under this CAS number, including other names
1-(Bromomethyl)-2,4-bis(trifluoromethyl)benzene 95% (CAS 140690-56-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A574304-1g |
| cas | 140690-56-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 437.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A574304 |
1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene (CAS 140690-56-8) is a chemical compound with the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. IUPAC name: 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene. InChIKey: SWFFFUJOWAJJCH-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6 |
|---|---|
| Molecular weight | 307.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene |
| InChIKey | SWFFFUJOWAJJCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CBr |
Computed by PubChem (NCBI)