CAS 140690-56-8 appears in our catalog under these names: 2,4-Bis(trifluoromethyl)benzyl bromide, 95%, 1-(Bromomethyl)-2,4-bis(trifluoromethyl)benzene, 98%, 2,4-Bis(trifluoromethyl)benzyl bromide, 97% , 1-(Bromomethyl)-2,4-bis(trifluoromethyl)benzene 95%, 2,4-BIS(TRIFLUOROMETHYL)BENZYL BROMIDE,&. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100mg, 250mg.
1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene (CAS 140690-56-8) is a chemical compound with the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. IUPAC name: 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene. InChIKey: SWFFFUJOWAJJCH-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6 |
|---|---|
| Molecular weight | 307.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene |
| InChIKey | SWFFFUJOWAJJCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CBr |
Computed by PubChem (NCBI)