cas: 140690-56-8 — see every product listed under this CAS number, including other names
2,4-Bis(trifluoromethyl)benzyl bromide (CAS 140690-56-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006022-100MG |
| cas | 140690-56-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 596.68 Pln | |
| Fluorochem | 5g | 1924.34 Pln |
| delivery time | 3-4 weeks |
|---|
1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene (CAS 140690-56-8) is a chemical compound with the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. IUPAC name: 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene. InChIKey: SWFFFUJOWAJJCH-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6 |
|---|---|
| Molecular weight | 307.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene |
| InChIKey | SWFFFUJOWAJJCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CBr |
Computed by PubChem (NCBI)