CAS 302911-98-4 appears in our catalog under these names: 2,5-Bis(trifluoromethyl)benzyl bromide, 98%, 2-(Bromomethyl)-1,4-bis(trifluoromethyl)benzene 98%, 2,5-BIS(TRIFLUOROMETHYL)BENZYL BROMIDE,&, 2,5-Bis(trifluoromethyl)benzyl bromide. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g.
2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene (CAS 302911-98-4) is a chemical compound with the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. IUPAC name: 2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene. InChIKey: CHSQGVCRNVEWIA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6 |
|---|---|
| Molecular weight | 307.03 g/mol |
| IUPAC name | 2-(bromomethyl)-1,4-bis(trifluoromethyl)benzene |
| InChIKey | CHSQGVCRNVEWIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CBr)C(F)(F)F |
Computed by PubChem (NCBI)