cas: 22162-14-7 — see every product listed under this CAS number, including other names
1-(Bromomethyl)-2-methyl-4-nitrobenzene 95% (CAS 22162-14-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A270284-250mg |
| cas | 22162-14-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A270284 |
1-(bromomethyl)-2-methyl-4-nitrobenzene (CAS 22162-14-7) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-(bromomethyl)-2-methyl-4-nitrobenzene. InChIKey: KEQVEPTWWMCODQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-(bromomethyl)-2-methyl-4-nitrobenzene |
| InChIKey | KEQVEPTWWMCODQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)