cas: 225656-59-7 — see every product listed under this CAS number, including other names
1-(Chloromethyl)-2-nitro-4-(trifluoromethyl)benzene 97% (CAS 225656-59-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A489761-250mg |
| cas | 225656-59-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 2278.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A489761 |
1-(chloromethyl)-2-nitro-4-(trifluoromethyl)benzene (CAS 225656-59-7) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: 1-(chloromethyl)-2-nitro-4-(trifluoromethyl)benzene. InChIKey: JWFRBTUSUAFGOS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | 1-(chloromethyl)-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | JWFRBTUSUAFGOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)