CAS 1261791-05-2 appears in our catalog under these names: 4-Chloro-2-(trifluoromethoxy)benzamide, 4-Chloro-2-(trifluoromethoxy)benzamide, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 250mg.
4-chloro-2-(trifluoromethoxy)benzamide (CAS 1261791-05-2) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: 4-chloro-2-(trifluoromethoxy)benzamide. InChIKey: MTYIZCXOBKSDPF-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethoxy)benzamide |
| InChIKey | MTYIZCXOBKSDPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OC(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)