CAS 225656-59-7 appears in our catalog under these names: 2-Nitro-4-(trifluoromethyl)benzyl chloride, 95%, 1-(Chloromethyl)-2-nitro-4-(trifluoromethyl)benzene, 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 10g, 250mg, 5g.
1-(chloromethyl)-2-nitro-4-(trifluoromethyl)benzene (CAS 225656-59-7) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: 1-(chloromethyl)-2-nitro-4-(trifluoromethyl)benzene. InChIKey: JWFRBTUSUAFGOS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | 1-(chloromethyl)-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | JWFRBTUSUAFGOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)