CAS 1000522-34-8 appears in our catalog under these names: 2-(3-Chloro-5-(trifluoromethyl)pyridin-2-yl)acetic acid, 95%, 2–(3–Chloro–5–(trifluoromethyl)pyridin–2–yl)acetic acid, Fluopyram-PAA. Offered by: Combi-blocks, AmBeed, GLPBio, HPC Standards. Available pack sizes: 1g, 250mg, 100mg, 50mg, 1x50mg.
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetic acid (CAS 1000522-34-8) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetic acid. InChIKey: ZCMWOZJSLGQSQV-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetic acid |
| InChIKey | ZCMWOZJSLGQSQV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)