cas: 1214358-17-4 — see every product listed under this CAS number, including other names
1-(Difluoromethyl)-2,3,5-trifluorobenzene, 98% (CAS 1214358-17-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1972963-5g |
| cas | 1214358-17-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10225.60 Pln | |
| AmBeed | 10g | 14287.84 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(difluoromethyl)-2,3,5-trifluorobenzene (CAS 1214358-17-4) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 1-(difluoromethyl)-2,3,5-trifluorobenzene. InChIKey: IDGVRAVWQIVVHG-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 1-(difluoromethyl)-2,3,5-trifluorobenzene |
| InChIKey | IDGVRAVWQIVVHG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)F)F)F)F |
Computed by PubChem (NCBI)