cas: 403-25-8 — see every product listed under this CAS number, including other names
1-(Difluoromethyl)-3-nitro-benzene, 98% (CAS 403-25-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F062905-1G |
| cas | 403-25-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 534.20 Pln | |
| Fluorochem | 25g | 2132.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(difluoromethyl)-3-nitrobenzene (CAS 403-25-8) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 1-(difluoromethyl)-3-nitrobenzene. InChIKey: QOGPXSPKXMNSLH-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 1-(difluoromethyl)-3-nitrobenzene |
| InChIKey | QOGPXSPKXMNSLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(F)F |
Computed by PubChem (NCBI)