CAS 442134-72-7 appears in our catalog under these names: 6-Amino-2,3-difluorobenzoic acid, 98%, 6-Amino-2,3-difluorobenzoic acid 98%, 6-Amino-2,3-difluorobenzoic acid, 98%, 98%, 2-Amino-5,6-difluorobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
6-amino-2,3-difluorobenzoic acid (CAS 442134-72-7) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 6-amino-2,3-difluorobenzoic acid. InChIKey: CKPWBLHHQXCINB-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 6-amino-2,3-difluorobenzoic acid |
| InChIKey | CKPWBLHHQXCINB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)F)F |
Computed by PubChem (NCBI)