CAS 1544-85-0 appears in our catalog under these names: 5-Amino-2,2-difluorobenzodioxole, 97%, 5–Amino–2,2–difluoro–1,3–benzodioxole, 5-Amino-2,2-difluoro-1,3-benzodioxole, 97+% , 5-Amino-2,2-difluoro-1,3-benzodioxole, >98.0%(GC)(T), 2,2-Difluorobenzo[d][1,3]dioxol-5-amine 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 250mg, 10g, 500g, 1kg.
2,2-difluoro-1,3-benzodioxol-5-amine (CAS 1544-85-0) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: CVYQRDKVWVBOFP-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | CVYQRDKVWVBOFP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)OC(O2)(F)F |
Computed by PubChem (NCBI)