CAS 1188412-98-7 appears in our catalog under these names: 1,5-Difluoro-2-methyl-3-nitrobenzene, 95%, 1,5-Difluoro-2-methyl-3-nitrobenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
1,5-difluoro-2-methyl-3-nitrobenzene (CAS 1188412-98-7) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 1,5-difluoro-2-methyl-3-nitrobenzene. InChIKey: FLVCMMRPNZCHPC-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 1,5-difluoro-2-methyl-3-nitrobenzene |
| InChIKey | FLVCMMRPNZCHPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)