CAS 1810071-88-5 is the registry number for 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-3-yl)-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-dimethyl-2-[3-(4-methylphenyl)phenyl]-5H-1,3-oxazole (CAS 1810071-88-5) is a chemical compound with the molecular formula C18H19NO and a molecular weight of 265.3 g/mol. IUPAC name: 4,4-dimethyl-2-[3-(4-methylphenyl)phenyl]-5H-1,3-oxazole. InChIKey: IBHGSRNTANFELJ-UHFFFAOYSA-N.
| Molecular formula | C18H19NO |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | 4,4-dimethyl-2-[3-(4-methylphenyl)phenyl]-5H-1,3-oxazole |
| InChIKey | IBHGSRNTANFELJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CC=C2)C3=NC(CO3)(C)C |
Computed by PubChem (NCBI)