Products 1038925-00-6

CAS 1038925-00-6 is the registry number for Sacubitril Impurity 3. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

(3S,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one (CAS 1038925-00-6) is a chemical compound with the molecular formula C18H19NO and a molecular weight of 265.3 g/mol. IUPAC name: (3S,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one. InChIKey: AFMGAVDATRJOJG-GUYCJALGSA-N.

Identity
Molecular formulaC18H19NO
Molecular weight265.3 g/mol
IUPAC name(3S,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one
InChIKeyAFMGAVDATRJOJG-GUYCJALGSA-N
SMILESC[C@H]1C[C@H](NC1=O)CC2=CC=C(C=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)