CAS 1038925-00-6 is the registry number for Sacubitril Impurity 3. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg.
(3S,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one (CAS 1038925-00-6) is a chemical compound with the molecular formula C18H19NO and a molecular weight of 265.3 g/mol. IUPAC name: (3S,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one. InChIKey: AFMGAVDATRJOJG-GUYCJALGSA-N.
| Molecular formula | C18H19NO |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | (3S,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one |
| InChIKey | AFMGAVDATRJOJG-GUYCJALGSA-N |
| SMILES | C[C@H]1C[C@H](NC1=O)CC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)