cas: 299921-01-0 — see every product listed under this CAS number, including other names
1-(Methylsulfonyl)indolin-5-amine, 98%, 98% (CAS 299921-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118JVW-100mg |
| cas | 299921-01-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1360.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-methylsulfonyl-2,3-dihydroindol-5-amine (CAS 299921-01-0) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 1-methylsulfonyl-2,3-dihydroindol-5-amine. InChIKey: JLXKFJCABSSCPF-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 1-methylsulfonyl-2,3-dihydroindol-5-amine |
| InChIKey | JLXKFJCABSSCPF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)