CAS 90556-91-5 appears in our catalog under these names: N-(4-Aminophenyl)-1,3-propanesultam, 98%, N-(4-Aminophenyl)-1,3-propanesultam. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g.
4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline (CAS 90556-91-5) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline. InChIKey: BISNTORNTSHTAX-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline |
| InChIKey | BISNTORNTSHTAX-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)