Products 1049982-19-5
CAS 1049982-19-5 is the registry number for (2S,4S)-4-(Thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S,4S)-4-(1,3-thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid (CAS 1049982-19-5) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: (2S,4S)-4-(1,3-thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid. InChIKey: UDEHZRASWYDPBH-SVRRBLITSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | (2S,4S)-4-(1,3-thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid |
| InChIKey | UDEHZRASWYDPBH-SVRRBLITSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CSC=N2 |
Computed by PubChem (NCBI)