CAS 847744-19-8 is the registry number for 3-(2-Mercapto-4,6-dimethylpyrimidin-5-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid (CAS 847744-19-8) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 3-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid. InChIKey: MCULFRXFRCFNQY-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 3-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid |
| InChIKey | MCULFRXFRCFNQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=S)N1)C)CCC(=O)O |
Computed by PubChem (NCBI)