Products 847744-19-8

CAS 847744-19-8 is the registry number for 3-(2-Mercapto-4,6-dimethylpyrimidin-5-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid (CAS 847744-19-8) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 3-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid. InChIKey: MCULFRXFRCFNQY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2O2S
Molecular weight212.27 g/mol
IUPAC name3-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid
InChIKeyMCULFRXFRCFNQY-UHFFFAOYSA-N
SMILESCC1=C(C(=NC(=S)N1)C)CCC(=O)O

Computed by PubChem (NCBI)