Products 2138121-01-2
CAS 2138121-01-2 is the registry number for 1-(Oxetan-3-yl)-1H-imidazole-4-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 1g, 250mg, 25mg, 50mg, 100mg.
1-(oxetan-3-yl)imidazole-4-carboxylic acid (CAS 2138121-01-2) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 1-(oxetan-3-yl)imidazole-4-carboxylic acid. InChIKey: BMWZWFMXSLCJPK-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 1-(oxetan-3-yl)imidazole-4-carboxylic acid |
| InChIKey | BMWZWFMXSLCJPK-UHFFFAOYSA-N |
| SMILES | C1C(CO1)N2C=C(N=C2)C(=O)O |
Computed by PubChem (NCBI)