Products 2138121-01-2

CAS 2138121-01-2 is the registry number for 1-(Oxetan-3-yl)-1H-imidazole-4-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(oxetan-3-yl)imidazole-4-carboxylic acid (CAS 2138121-01-2) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 1-(oxetan-3-yl)imidazole-4-carboxylic acid. InChIKey: BMWZWFMXSLCJPK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O3
Molecular weight168.15 g/mol
IUPAC name1-(oxetan-3-yl)imidazole-4-carboxylic acid
InChIKeyBMWZWFMXSLCJPK-UHFFFAOYSA-N
SMILESC1C(CO1)N2C=C(N=C2)C(=O)O

Computed by PubChem (NCBI)