cas: 1389323-51-6 — see every product listed under this CAS number, including other names
1-(Oxetan-3-yl)-1h-pyrazole-4-carboxylic acid, 97% (CAS 1389323-51-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F639840-50MG |
| cas | 1389323-51-6 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 778.91 Pln | |
| Fluorochem | 100mg | 862.21 Pln | |
| Fluorochem | 250mg | 1132.95 Pln | |
| Fluorochem | 500mg | 2143.01 Pln | |
| Fluorochem | 1g | 2278.38 Pln | |
| Fluorochem | 2.5g | 5553.27 Pln | |
| Fluorochem | 5g | 7724.38 Pln | |
| Fluorochem | 10g | 15383.14 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-(oxetan-3-yl)pyrazole-4-carboxylic acid (CAS 1389323-51-6) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 1-(oxetan-3-yl)pyrazole-4-carboxylic acid. InChIKey: HBZDAQAXRCGWBI-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 1-(oxetan-3-yl)pyrazole-4-carboxylic acid |
| InChIKey | HBZDAQAXRCGWBI-UHFFFAOYSA-N |
| SMILES | C1C(CO1)N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)