CAS 1389323-51-6 appears in our catalog under these names: 1-(Oxetan-3-yl)-1H-pyrazole-4-carboxylic acid, 1-(Oxetan-3-yl)-1h-pyrazole-4-carboxylic acid, 97%, 97%, 1-(Oxetan-3-yl)-1h-pyrazole-4-carboxylic acid, 97%, 1-(Oxetan-3-yl)-1H-pyrazole-4-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 5g, 2.5g.
1-(oxetan-3-yl)pyrazole-4-carboxylic acid (CAS 1389323-51-6) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 1-(oxetan-3-yl)pyrazole-4-carboxylic acid. InChIKey: HBZDAQAXRCGWBI-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 1-(oxetan-3-yl)pyrazole-4-carboxylic acid |
| InChIKey | HBZDAQAXRCGWBI-UHFFFAOYSA-N |
| SMILES | C1C(CO1)N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)